For research use only. Not for therapeutic Use.
Sphingosine (d14:1)（Cat No.:R013834）is a bioactive sphingolipid, characterized by a 14-carbon long-chain base with a single unsaturation at the 4th position. It plays a critical role in cellular signaling, acting as a precursor in the synthesis of other sphingolipids, including sphingomyelins and ceramides. Sphingosine (d14:1) is involved in regulating cell growth, apoptosis, and inflammation. It can also influence the balance of pro-apoptotic and anti-apoptotic signals within cells. Research has explored its potential therapeutic applications in cancer, neurodegenerative diseases, and metabolic disorders, though further studies are required to understand its full therapeutic potential.
| CAS Number | 24558-60-9 |
| Synonyms | (E,2S,3R)-2-aminotetradec-4-ene-1,3-diol |
| Molecular Formula | C14H29NO2 |
| Purity | ≥95% |
| IUPAC Name | (E,2S,3R)-2-aminotetradec-4-ene-1,3-diol |
| InChI | InChI=1S/C14H29NO2/c1-2-3-4-5-6-7-8-9-10-11-14(17)13(15)12-16/h10-11,13-14,16-17H,2-9,12,15H2,1H3/b11-10+/t13-,14+/m0/s1 |
| InChIKey | VDRZDTXJMRRVMF-NXFSIWHZSA-N |
| SMILES | CCCCCCCCC/C=C/[C@H]([C@H](CO)N)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
