For research use only. Not for therapeutic Use.
Sorbicillin（Cat No.:I043829）is a natural product and a type of fungal metabolite known for its antifungal and antimicrobial properties. It is produced by various species of fungi, particularly from the genus Penicillium. Sorbicillin has been shown to inhibit the growth of several pathogenic fungi and bacteria, making it valuable in the development of antimicrobial agents. Its mechanism of action involves disrupting cell wall synthesis and inhibiting enzyme activity. Sorbicillin is of interest in medicinal chemistry for its potential use in treating fungal infections and for its role in exploring new classes of antifungal agents.
| CAS Number | 79950-85-9 |
| Synonyms | (2E,4E)-1-(2,4-dihydroxy-3,5-dimethylphenyl)hexa-2,4-dien-1-one |
| Molecular Formula | C14H16O3 |
| Purity | ≥95% |
| IUPAC Name | (2E,4E)-1-(2,4-dihydroxy-3,5-dimethylphenyl)hexa-2,4-dien-1-one |
| InChI | InChI=1S/C14H16O3/c1-4-5-6-7-12(15)11-8-9(2)13(16)10(3)14(11)17/h4-8,16-17H,1-3H3/b5-4+,7-6+ |
| InChIKey | RKKPUBAAIGFXOG-YTXTXJHMSA-N |
| SMILES | C/C=C/C=C/C(=O)C1=C(C(=C(C(=C1)C)O)C)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
