For research use only. Not for therapeutic Use.
SN-38(Cat No.:I005211)is the active metabolite of irinotecan, a chemotherapeutic agent used to treat cancers, particularly colorectal cancer. It exerts its anticancer effects by inhibiting topoisomerase I, an enzyme crucial for DNA replication and transcription. By stabilizing the enzyme-DNA complex, SN-38 induces DNA strand breaks, leading to cell death, particularly in rapidly dividing cancer cells. Though more potent than irinotecan, SN-38’s clinical use is limited due to poor solubility and rapid clearance. Efforts to enhance its therapeutic profile involve drug delivery systems and prodrug formulations to improve stability and bioavailability.
CAS Number | 86639-52-3 |
Synonyms | 7-Ethyl-10-Hydroxycamptothecin;7-ethyl-10-hydroxy-20(S)-Camptothecin;NK 012 |
Molecular Formula | C22H20N2O5 |
Purity | ≥95% |
Target | Cell Cycle/DNA Damage |
Solubility | DMSO: ≥ 40 mg/mL |
Storage | -20℃ |
IUPAC Name | (19S)-10,19-diethyl-7,19-dihydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
InChI | InChI=1S/C22H20N2O5/c1-3-12-13-7-11(25)5-6-17(13)23-19-14(12)9-24-18(19)8-16-15(20(24)26)10-29-21(27)22(16,28)4-2/h5-8,25,28H,3-4,9-10H2,1-2H3/t22-/m0/s1 |
InChIKey | FJHBVJOVLFPMQE-QFIPXVFZSA-N |
SMILES | CCC1=C2CN3C(=CC4=C(C3=O)COC(=O)[C@@]4(CC)O)C2=NC5=C1C=C(C=C5)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |