For research use only. Not for therapeutic Use.
SEN177（Cat No.:I036213）is a selective small molecule inhibitor that targets the C-terminus of the protein S100A9, a member of the S100 family of calcium-binding proteins involved in inflammation and immune response regulation. By inhibiting S100A9, SEN177 modulates the activation of inflammatory pathways and has shown potential in reducing excessive immune responses associated with diseases such as rheumatoid arthritis and other autoimmune disorders. SEN177’s ability to target S100A9-mediated inflammation makes it a promising therapeutic agent for managing chronic inflammatory conditions and potentially offering a new approach for immune-related diseases.
| CAS Number | 2117405-13-5 |
| Synonyms | 2-fluoro-5-[2-[4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]pyridin-3-yl]pyridine |
| Molecular Formula | C18H19FN6 |
| Purity | ≥95% |
| IUPAC Name | 2-fluoro-5-[2-[4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]pyridin-3-yl]pyridine |
| InChI | InChI=1S/C18H19FN6/c1-24-12-22-23-17(24)13-6-9-25(10-7-13)18-15(3-2-8-20-18)14-4-5-16(19)21-11-14/h2-5,8,11-13H,6-7,9-10H2,1H3 |
| InChIKey | AJIAMIPUWJQSPR-UHFFFAOYSA-N |
| SMILES | CN1C=NN=C1C2CCN(CC2)C3=C(C=CC=N3)C4=CN=C(C=C4)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
