For research use only. Not for therapeutic Use.
SC144(CAT: I005357) is a first-in-class small molecule inhibitor targeting glycoprotein 130 (gp130), a key component of the IL-6 receptor family signaling pathway. It disrupts gp130-mediated signal transduction, inhibiting downstream JAK/STAT3 signaling, which is often implicated in cancer and inflammatory diseases. SC144 exhibits potent antiproliferative activity in various cancer models, particularly those with STAT3 hyperactivation. It is a valuable tool for studying gp130-related pathways, advancing research on cancer therapeutics, and exploring anti-inflammatory strategies. Its high selectivity and effectiveness make it a reliable compound for investigating novel treatments targeting the IL-6/gp130 axis.
| CAS Number | 895158-95-9 |
| Molecular Formula | C16H11FN6O |
| Purity | ≥95% |
| Target | Apoptosis |
| Solubility | DMSO: ≥ 19.5 mg/mL |
| Storage | Store at -20°C |
| IC50 | < 1 uM (Cell assay) |
| IUPAC Name | N'-(7-fluoropyrrolo[1,2-a]quinoxalin-4-yl)pyrazine-2-carbohydrazide |
| InChI | 1S/C16H11FN6O/c17-10-3-4-13-11(8-10)20-15(14-2-1-7-23(13)14)21-22-16(24)12-9-18-5-6-19-12/h1-9H,(H,20,21)(H,22,24) |
| InChIKey | UEADAWQSJOWXBK-UHFFFAOYSA-N |
| SMILES | C1=CN2C3=C(C=C(C=C3)F)N=C(C2=C1)NNC(=O)C4=NC=CN=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
