For research use only. Not for therapeutic Use.
SANT-2（Cat No.:I010794）is a small-molecule antagonist of the Smoothened (SMO) receptor, a key component of the Hedgehog (Hh) signaling pathway. By inhibiting SMO, SANT-2 effectively blocks downstream signaling involved in cell proliferation, differentiation, and tissue patterning. This pathway is aberrantly activated in various cancers, including basal cell carcinoma and medulloblastoma. SANT-2 is widely used in cancer and developmental biology research to study Hedgehog pathway mechanisms and evaluate therapeutic strategies targeting SMO. Its high specificity and potency make it a valuable tool for dissecting Hh-mediated cellular processes and tumorigenesis.
| CAS Number | 329196-48-7 |
| Synonyms | N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-3,4,5-triethoxybenzamide |
| Molecular Formula | C26H26ClN3O4 |
| Purity | ≥95% |
| IUPAC Name | N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-3,4,5-triethoxybenzamide |
| InChI | InChI=1S/C26H26ClN3O4/c1-4-32-22-13-16(14-23(33-5-2)24(22)34-6-3)26(31)28-17-11-12-19(27)18(15-17)25-29-20-9-7-8-10-21(20)30-25/h7-15H,4-6H2,1-3H3,(H,28,31)(H,29,30) |
| InChIKey | VQOJFGFKIVFMDH-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=CC(=C1OCC)OCC)C(=O)NC2=CC(=C(C=C2)Cl)C3=NC4=CC=CC=C4N3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
