For research use only. Not for therapeutic Use.
Sanguisorbigenin(Cat No.:I044830)is a pentacyclic triterpenoid aglycone derived from plants in the Sanguisorba genus, commonly used in traditional Chinese medicine for their hemostatic and anti-inflammatory properties. Structurally, it belongs to the oleanane-type triterpenes, characterized by hydroxyl and carboxyl functional groups that contribute to its bioactivity. Sanguisorbigenin exhibits a range of pharmacological effects, including anti-inflammatory, antioxidant, and antitumor activities, often through modulation of NF-κB and MAPK signaling pathways. Its potent biological properties make it a promising candidate for therapeutic development in treating inflammation, cancer, and other oxidative stress-related disorders.
| CAS Number | 6812-98-2 |
| Synonyms | (4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-4,5,6,6a,7,8,8a,10,11,12,13,14b-dodecahydro-3H-picene-4a-carboxylic acid |
| Molecular Formula | C30H46O3 |
| Purity | ≥95% |
| IUPAC Name | (4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-4,5,6,6a,7,8,8a,10,11,12,13,14b-dodecahydro-3H-picene-4a-carboxylic acid |
| InChI | InChI=1S/C30H46O3/c1-18-10-15-30(25(32)33)17-16-28(6)20(24(30)19(18)2)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h8,21-24,31H,9-17H2,1-7H3,(H,32,33)/t21-,22+,23-,24-,27-,28+,29+,30-/m0/s1 |
| InChIKey | HKJOHXSLBNLQHF-OXLNSTONSA-N |
| SMILES | CC1=C([C@H]2C3=CC[C@@H]4[C@]5(CC[C@@H](C([C@@H]5CC[C@]4([C@@]3(CC[C@]2(CC1)C(=O)O)C)C)(C)C)O)C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |