Salcaprozate Sodium (Cat No.:I000062) is an oral absorption enhancer that improves the bioavailability of various drugs, especially those with poor solubility or stability in the gastrointestinal tract. It facilitates the transport of drugs across the intestinal membrane without altering their chemical structure. SNAC is notably used in formulations to enhance the absorption of peptides and proteins, including insulin and other biopharmaceuticals. Its ability to increase drug absorption while maintaining safety and efficacy makes it a valuable tool in pharmaceutical development, enabling more effective oral delivery of therapeutics.
| Catalog Number | I000062 |
| CAS Number | 203787-91-1 |
| Synonyms | SNAC;sodium 8-((2-hydroxybenzoyl) amino) octanoate |
| Molecular Formula | C15H20NNaO4 |
| Purity | ≥95% |
| Storage | Store at 0-8°C |
| IUPAC Name | sodium;8-[(2-hydroxybenzoyl)amino]octanoate |
| InChI | InChI=1S/C15H21NO4.Na/c17-13-9-6-5-8-12(13)15(20)16-11-7-3-1-2-4-10-14(18)19;/h5-6,8-9,17H,1-4,7,10-11H2,(H,16,20)(H,18,19);/q;+1/p-1 |
| InChIKey | UOENJXXSKABLJL-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C(=C1)C(=O)NCCCCCCCC(=O)[O-])O.[Na+] |
