Salcaprozate sodium(CAT: I000062) is an oral absorption enhancer that has the potential to act as a delivery agent for oral forms of heparin and insulin. Salcaprozate sodium increases the lipophilicity caused by the complexation of non-covalent macromolecules, thus increasing the passive transcellular penetration of small intestinal epithelial cells. This product is used for medical research and development and other scientific research purposes.
| Catalog Number | I000062 |
| CAS Number | 203787-91-1 |
| Synonyms | SNAC;sodium 8-((2-hydroxybenzoyl) amino) octanoate |
| Molecular Formula | C15H20NNaO4 |
| Purity | 95% |
| Storage | Store at 0-8°C |
| IUPAC Name | sodium;8-[(2-hydroxybenzoyl)amino]octanoate |
| InChI | InChI=1S/C15H21NO4.Na/c17-13-9-6-5-8-12(13)15(20)16-11-7-3-1-2-4-10-14(18)19;/h5-6,8-9,17H,1-4,7,10-11H2,(H,16,20)(H,18,19);/q;+1/p-1 |
| InChIKey | UOENJXXSKABLJL-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C(=C1)C(=O)NCCCCCCCC(=O)[O-])O.[Na+] |
| Reference | 1: Riley MG, York RG. Peri- and postnatal developmental toxicity of salcaprozate sodium (SNAC) in Sprague-Dawley rats. Int J Toxicol. 2009 Jul-Aug;28(4):266-77. doi: 10.1177/1091581809337736. PubMed PMID: 19636070.<br /> |
