Saxitoxin dihydrochloride is a highly potent neurotoxin that acts as a sodium channel blocker, derived from marine dinoflagellates and cyanobacteria. It is the primary agent responsible for paralytic shellfish poisoning (PSP) when consumed through contaminated seafood. Saxitoxin dihydrochloride binds to sodium channels in nerve cells, preventing the transmission of nerve impulses, which can lead to paralysis and potentially fatal respiratory failure. This compound is crucial in research and environmental monitoring for detecting and managing PSP risks in seafood.
| Catalog Number | T000035 |
| CAS Number | 35554-08-6 |
| Synonyms | Saxitoxin dihydrochloride |
| Molecular Formula | C10H19Cl2N7O4 |
| Purity | 95% |
| Storage | 2-8°C |
| Related CAS | 35523-89-8(free base) |
| IUPAC Name | [(3aS,4R,10aS)-2,6-diamino-10,10-dihydroxy-3a,4,8,9-tetrahydro-3H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate;dihydrochloride |
| InChI | InChI=1S/C10H17N7O4.2ClH/c11-6-15-5-4(3-21-8(13)18)14-7(12)17-2-1-9(19,20)10(5,17)16-6;;/h4-5,19-20H,1-3H2,(H2,12,14)(H2,13,18)(H3,11,15,16);2*1H/t4-,5-,10-;;/m0../s1 |
| InChIKey | YHAHUGQQOBPXOZ-UIPPETONSA-N |
| SMILES | C1CN2C(=NC(C3C2(C1(O)O)N=C(N3)N)COC(=O)N)N.Cl.Cl |
