For research use only. Not for therapeutic Use.
(S)-Minzasolmin(CAT: I040624) is a selective, stereoisomeric small-molecule compound developed as a monoamine receptor modulator, primarily studied for its potential antipsychotic and antidepressant effects. As the (S)-enantiomer, it exhibits enhanced receptor binding specificity and pharmacodynamic properties compared to its racemic or (R)-form counterparts. (S)-Minzasolmin acts on key neurotransmitter systems, such as serotonin and dopamine pathways, making it a valuable tool in neuropharmacological research. It supports investigations into psychiatric disorders, including schizophrenia and major depressive disorder, and aids in the development of CNS-targeted therapies.
| CAS Number | 1802518-91-7 |
| Synonyms | N-[(2S)-1-(1H-indol-3-yl)hexan-2-yl]-2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carboxamide |
| Molecular Formula | C23H31N5OS |
| Purity | ≥95% |
| IUPAC Name | N-[(2S)-1-(1H-indol-3-yl)hexan-2-yl]-2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carboxamide |
| InChI | InChI=1S/C23H31N5OS/c1-3-4-7-18(14-17-15-24-20-9-6-5-8-19(17)20)26-22(29)21-16-25-23(30-21)28-12-10-27(2)11-13-28/h5-6,8-9,15-16,18,24H,3-4,7,10-14H2,1-2H3,(H,26,29)/t18-/m0/s1 |
| InChIKey | GDFWCSZNQVAQGR-SFHVURJKSA-N |
| SMILES | CCCCC(CC1=CNC2=CC=CC=C21)NC(=O)C3=CN=C(S3)N4CCN(CC4)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
