Home
>
Chemical Reagents>Organic Building Blocks> (S)-Benzyl 2,5-diamino-5-oxopentanoate hydrochloride
For research use only. Not for therapeutic Use.
(S)-Benzyl 2,5-diamino-5-oxopentanoate hydrochloride(CAT: L000032) is a chemical compound of significance primarily in pharmaceutical and organic chemistry. In the pharmaceutical field, it serves as an important intermediate in the synthesis of various medications, impacting specific biological targets. Its action method involves its incorporation into drug molecules, contributing to the development of novel pharmaceutical agents.
CAS Number | 2419-53-6 |
Molecular Formula | C12H17ClN2O3 |
Purity | ≥95% |
IUPAC Name | benzyl (2S)-2,5-diamino-5-oxopentanoate;hydrochloride |
InChI | InChI=1S/C12H16N2O3.ClH/c13-10(6-7-11(14)15)12(16)17-8-9-4-2-1-3-5-9;/h1-5,10H,6-8,13H2,(H2,14,15);1H/t10-;/m0./s1 |
InChIKey | VWUBGABLTZAUKP-PPHPATTJSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |