1. Home
  2. Product
  3. Chemical Reagents
  4. Heterocyclic Building Blocks
  5. 4-(Pyridin-4-yl)pyrimidine

4-(Pyridin-4-yl)pyrimidine - CAS 53345-78-1

4-(Pyridin-4-yl)pyrimidine（Cat No.:L006769）. It consists of a pyridine ring and a pyrimidine ring, fused with the pyridinyl group attached at the 4-position of the pyrimidine ring. This compound is a heterocyclic aromatic molecule used in organic synthesis, specifically in medicinal chemistry and drug discovery. Its unique structure and potential for diverse chemical transformations make it valuable in the development of pharmaceuticals and biologically active compounds. Researchers utilize it as a building block to create novel molecules, contributing to advancements in drug design and the search for new therapeutic agents.

Catalog Number: L006769

CAS Number: 53345-78-1

Molecular Formula: C9H7N3

Molecular Weight:157.17

Purity: ≥95%

Online inquiry

* For research use only. Not for human or veterinary use.


Property

Molecular Formula: C9H7N3
Molecular Weight157.17
Purity≥95%

Computed Descriptor

IUPAC Name4-pyridin-4-ylpyrimidine
InChIInChI=1S/C9H7N3/c1-4-10-5-2-8(1)9-3-6-11-7-12-9/h1-7H
InChIKeyUACHOGFPFNIAIG-UHFFFAOYSA-N
SMILESC1=CN=CC=C1C2=NC=NC=C2