(S)-2-Amino-3-(4-chlorophenyl)propan-1-ol hydrochloride(Cat No.:L006811). This compound holds significance in medicinal chemistry and drug development due to its chiral nature. It is often used as a key intermediate in the synthesis of pharmaceuticals and biologically active molecules. The hydrochloride form enhances its solubility and stability, making it suitable for various chemical reactions and formulations. Researchers employ it in the creation of pharmaceuticals, contributing to advancements in drug discovery and the development of potential therapeutic agents.
Catalog Number | L006811 |
CAS Number | 1956434-75-5 |
Molecular Formula | C9H13Cl2NO |
Purity | 95% |
Storage | Room Temperature |
IUPAC Name | (2S)-2-amino-3-(4-chlorophenyl)propan-1-ol;hydrochloride |
InChI | InChI=1S/C9H12ClNO.ClH/c10-8-3-1-7(2-4-8)5-9(11)6-12;/h1-4,9,12H,5-6,11H2;1H/t9-;/m0./s1 |
InChIKey | VLDWUIKCXWULET-FVGYRXGTSA-N |
SMILES | C1=CC(=CC=C1CC(CO)N)Cl.Cl |