Home
>
Chemical Reagents>Chiral Reagents> (S)-2-Amino-2-(2,4-difluorophenyl)acetic acid hydrochloride
For research use only. Not for therapeutic Use.
(S)-2-Amino-2-(2,4-difluorophenyl)acetic acid hydrochloride (Cat.No:L004019) is a crucial compound in pharmaceutical research. Its enantiopure form, containing a difluorophenyl and aminoacetic acid motif, shows promise in drug development. This compound is utilized as a key intermediate in the synthesis of specialized pharmaceutical agents, particularly for its potential in the treatment of neurological disorders.
| CAS Number | 2241594-33-0 |
| Molecular Formula | C8H8ClF2NO2 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-amino-2-(2,4-difluorophenyl)acetic acid;hydrochloride |
| InChI | InChI=1S/C8H7F2NO2.ClH/c9-4-1-2-5(6(10)3-4)7(11)8(12)13;/h1-3,7H,11H2,(H,12,13);1H/t7-;/m0./s1 |
| InChIKey | WIXGQKSSYMPCBH-FJXQXJEOSA-N |
| SMILES | C1=CC(=C(C=C1F)F)[C@@H](C(=O)O)N.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |