Home
>
Chemical Reagents>Chiral Reagents>
>
(S)-1-(3-(Trifluoromethoxy)phenyl)ethanamine hydrochloride
(S)-1-(3-(Trifluoromethoxy)phenyl)ethanamine hydrochloride (Cat.No:L003851) is a vital compound in pharmaceutical research. Its enantiomeric purity and trifluoromethoxyphenyl group make it a valuable building block for drug development. This compound’s unique structure allows for the creation of diverse bioactive molecules, showing promise in the development of innovative pharmaceuticals.
Catalog Number | L003851 |
CAS Number | 1391567-48-8 |
Molecular Formula | C9H11ClF3NO |
Purity | ≥95% |
IUPAC Name | (1S)-1-[3-(trifluoromethoxy)phenyl]ethanamine;hydrochloride |
InChI | InChI=1S/C9H10F3NO.ClH/c1-6(13)7-3-2-4-8(5-7)14-9(10,11)12;/h2-6H,13H2,1H3;1H/t6-;/m0./s1 |
InChIKey | GILTYZBJXXHWGV-RGMNGODLSA-N |
SMILES | C[C@@H](C1=CC(=CC=C1)OC(F)(F)F)N.Cl |