Ruxolitinib, free base（Cat No.:A000579）is an oral Janus kinase (JAK) inhibitor that selectively targets JAK1 and JAK2, critical enzymes involved in hematopoietic cell signaling pathways. It is primarily used to treat myelofibrosis and polycythemia vera, conditions characterized by excessive blood cell production and related symptoms. By inhibiting these JAK pathways, ruxolitinib reduces inflammation, alleviates splenomegaly, and improves overall quality of life for patients. Its ability to modulate immune responses also suggests potential applications in other inflammatory and autoimmune disorders, making ruxolitinib a significant therapeutic option in hematology and beyond.
| Catalog Number | A000579 |
| CAS Number | 941678-49-5 |
| Synonyms | NA |
| Molecular Formula | C₁₇H₁₈N₆ |
| Purity | ≥95% |
| Target | JAK |
| Solubility | >15.3mg/mL in DMSO |
| Storage | 3 years -20C powder |
| IUPAC Name | (3R)-3-cyclopentyl-3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]propanenitrile |
| InChI | InChI=1S/C17H18N6/c18-7-5-15(12-3-1-2-4-12)23-10-13(9-22-23)16-14-6-8-19-17(14)21-11-20-16/h6,8-12,15H,1-5H2,(H,19,20,21)/t15-/m1/s1 |
| InChIKey | HFNKQEVNSGCOJV-OAHLLOKOSA-N |
| SMILES | C1CCC(C1)[C@@H](CC#N)N2C=C(C=N2)C3=C4C=CNC4=NC=N3 |
