For research use only. Not for therapeutic Use.
Ronopterin (also known as VAS203) is a nitric oxide synthase (NOS) inhibitor being investigated for its neuroprotective effects, particularly in the treatment of traumatic brain injury (TBI). By inhibiting the overproduction of nitric oxide, which can lead to oxidative stress and neuronal damage, Ronopterin aims to reduce brain swelling and improve neurological outcomes in TBI patients. Clinical studies have explored its potential to limit secondary brain injury, offering hope for more effective management of TBI and improved patient recovery.
| Catalog Number | I009182 |
| CAS Number | 206885-38-3 |
| Synonyms | VAS-203; VAS 203; VAS203; Ronopterin;(1R,2S)-1-[(6RS)-2,4-diamino-5,6,7,8-tetrahydropteridin- 6-yl]propane-1,2-diol |
| Molecular Formula | C9H16N6O2 |
| Purity | ≥95% |
| Target | Nitric oxide synthase inhibitor |
| Solubility | Soluble in DMSO, not in water |
| Storage | 0 - 4 °C for short term, or -20 °C for long term |
| SMILES | C[C@H](O)[C@@H](C1NC2=C(N)N=C(N)N=C2NC1)O |
