For research use only. Not for therapeutic Use.
Rocaglamide (CAT: I005059) is a natural product derived from the Aglaia genus of plants. It is known for its potent anticancer activity and has been extensively studied as a potential therapeutic agent. Rocaglamide exhibits a broad range of pharmacological activities, including inhibition of protein synthesis, induction of apoptosis, modulation of signaling pathways, and anti-inflammatory effects. It has shown promising activity against various cancer types, including leukemia, breast cancer, and lung cancer. Rocaglamide’s mechanism of action involves targeting multiple cellular pathways involved in cancer progression, making it a promising candidate for further drug development and research.
| CAS Number | 84573-16-0 |
| Synonyms | NSC 326408;Roc-A;Rocaglamide A |
| Molecular Formula | C₂₉H₃₁NO₇ |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Solubility | 10 mM in DMSO |
| Storage | -20°C |
| IC50 | 50 nM (for the heat shock reporter) |
| InChI | InChI=1S/C29H31NO7/c1-30(2)27(32)23-24(17-9-7-6-8-10-17)29(18-11-13-19(34-3)14-12-18)28(33,26(23)31)25-21(36-5)15-20(35-4)16-22(25)37-29/h6-16,23-24,26,31,33H,1-5H3/t23-,24-,26-,28+,29+/m1/s1 |
| InChIKey | DAPAQENNNINUPW-IDAMAFBJSA-N |
| SMILES | CN(C)C(=O)C1C(C2(C(C1O)(C3=C(C=C(C=C3O2)OC)OC)O)C4=CC=C(C=C4)OC)C5=CC=CC=C5 |
| Reference | 1. Nat Prod Rep. 2014 Jul;31(7):924-39. doi: 10.1039/c4np00006d. Epub 2014 May 2. <br> 2. ISRN Org Chem. 2011 Apr 4;2011:239817. doi: 10.5402/2011/239817. |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |