For research use only. Not for therapeutic Use.
Rivastigmine Tartrate(Cat No.:A001087)is a potent acetylcholinesterase inhibitor widely used in the treatment of mild to moderate Alzheimer’s disease and Parkinson’s disease dementia. It enhances cholinergic function by increasing acetylcholine levels in the brain, leading to improved cognitive function and memory. Rivastigmine Tartrate, known for its high purity and stability, is essential for pharmaceutical research and drug development. Its effective inhibition of acetylcholinesterase makes it a crucial compound for studies aimed at understanding and combating neurodegenerative disorders. Ideal for clinical and laboratory use, it supports advanced therapeutic research.
| CAS Number | 129101-54-8 |
| Synonyms | ENA 713 |
| Molecular Formula | C14H22N2O2 • C4H6O6 |
| Purity | ≥95% |
| Target | Cholinesterase (ChE) |
| Solubility | Soluble in DMSO > 10 mM |
| Storage | 3 years -20C powder |
| IUPAC Name | (2R,3R)-2,3-dihydroxybutanedioic acid;[3-[(1S)-1-(dimethylamino)ethyl]phenyl] N-ethyl-N-methylcarbamate |
| InChI | InChI=1S/C14H22N2O2.C4H6O6/c1-6-16(5)14(17)18-13-9-7-8-12(10-13)11(2)15(3)4;5-1(3(7)8)2(6)4(9)10/h7-11H,6H2,1-5H3;1-2,5-6H,(H,7,8)(H,9,10)/t11-;1-,2-/m01/s1 |
| InChIKey | GWHQHAUAXRMMOT-MBANBULQSA-N |
| SMILES | CCN(C)C(=O)OC1=CC=CC(=C1)C(C)N(C)C.C(C(C(=O)O)O)(C(=O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |