Resazurin is a blue non-<wbr></wbr>fluorescent dye that when reduced to the highly red-<wbr></wbr>fluorescent product resorufin (excitation: 530-<wbr></wbr>540 nm; emission: 585-<wbr></wbr>595 nm) can be used as a quantifiable detection agent for enzyme activity assays. The non-<wbr></wbr>fluorescent resazurin can be used as an oxidation-<wbr></wbr>reduction indicator in cell viability assays in a variety of cells.
| Catalog Number | R018171 |
| CAS Number | 62758-13-8 |
| Synonyms | 7-Hydroxy-3H-Phenoxazin-3-one-10-oxide Sodium Salt; Sodium Resazurin; |
| Molecular Formula | C12H6NNaO4 |
| Purity | 95% |
| Storage | Room temperature |
| IUPAC Name | sodium;10-oxido-7-oxophenoxazin-10-ium-3-olate |
| InChI | InChI=1S/C12H7NO4.Na/c14-7-1-3-9-11(5-7)17-12-6-8(15)2-4-10(12)13(9)16;/h1-6,14H;/q;+1/p-1 |
| InChIKey | IVGPGQSSDLDOLH-UHFFFAOYSA-M |
| SMILES | C1=CC2=C(C=C1[O-])OC3=CC(=O)C=CC3=[N+]2[O-].[Na+] |
