For research use only. Not for therapeutic Use.
(R)-GDC-0927(CAT: I040705) is a potent and selective oral selective estrogen receptor degrader (SERD) developed for the treatment of estrogen receptor-positive (ER⁺) breast cancer. It binds to the estrogen receptor alpha (ERα) and promotes its degradation, effectively inhibiting estrogen-driven transcriptional activity and tumor growth. (R)-GDC-0927 demonstrates strong anti-tumor efficacy in preclinical models, including those resistant to standard endocrine therapies such as tamoxifen or aromatase inhibitors. With favorable oral bioavailability and a well-characterized pharmacokinetic profile, (R)-GDC-0927 is a valuable compound in oncology research for developing next-generation hormone therapies targeting ER⁺ breast cancers.
| CAS Number | 1642297-53-7 |
| Synonyms | (2R)-2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(3-hydroxyphenyl)-4-methyl-2H-chromen-6-ol |
| Molecular Formula | C28H28FNO4 |
| Purity | ≥95% |
| IUPAC Name | (2R)-2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(3-hydroxyphenyl)-4-methyl-2H-chromen-6-ol |
| InChI | InChI=1S/C28H28FNO4/c1-18-25-14-23(32)7-10-26(25)34-28(27(18)21-3-2-4-22(31)13-21)20-5-8-24(9-6-20)33-12-11-30-16-19(15-29)17-30/h2-10,13-14,19,28,31-32H,11-12,15-17H2,1H3/t28-/m1/s1 |
| InChIKey | KJAAPZIFCQQQKX-MUUNZHRXSA-N |
| SMILES | CC1=C([C@H](OC2=C1C=C(C=C2)O)C3=CC=C(C=C3)OCCN4CC(C4)CF)C5=CC(=CC=C5)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
