For research use only. Not for therapeutic Use.
(R)-5-O-Benzoyl-1,2-di-O-isopropylidene-alpha-D-xylofuranose(Cat No.:I041266)is a synthetic carbohydrate derivative with protective groups designed for use in organic synthesis. The molecule features a xylofuranose sugar core, which is a sugar in a furanose (five-membered ring) form, modified with benzoyl and isopropylidene groups to protect hydroxyl groups during chemical reactions. This compound is primarily used in carbohydrate chemistry for the synthesis of more complex molecules, such as glycosides or other modified sugars. Its structure and functional groups make it useful in various synthetic pathways, particularly in the field of glycoscience and medicinal chemistry.
| CAS Number | 6612-91-5 |
| Synonyms | [(3aR,5R,6R,6aR)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl benzoate |
| Molecular Formula | C15H18O6 |
| Purity | ≥95% |
| IUPAC Name | (6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methyl benzoate |
| InChI | InChI=1S/C15H18O6/c1-15(2)20-12-11(16)10(19-14(12)21-15)8-18-13(17)9-6-4-3-5-7-9/h3-7,10-12,14,16H,8H2,1-2H3 |
| InChIKey | WKRBIHIDJVMVGS-UHFFFAOYSA-N |
| SMILES | CC1(OC2C(C(OC2O1)COC(=O)C3=CC=CC=C3)O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |