(R)-1-(5-Bromopyridin-3-yl)ethanamine (Cat.No:L003730) is a pivotal compound in pharmaceutical research. Its chiral nature, coupled with a bromopyridine moiety, imparts unique reactivity and pharmacological properties. This compound serves as a crucial intermediate in the synthesis of biologically active molecules, making it valuable in drug development.
Catalog Number | L003730 |
CAS Number | 1212905-37-7 |
Molecular Formula | C7H9BrN2 |
Purity | 95% |
IUPAC Name | (1R)-1-(5-bromopyridin-3-yl)ethanamine |
InChI | InChI=1S/C7H9BrN2/c1-5(9)6-2-7(8)4-10-3-6/h2-5H,9H2,1H3/t5-/m1/s1 |
InChIKey | JVXAQAZTSXAUQX-RXMQYKEDSA-N |
SMILES | C[C@H](C1=CC(=CN=C1)Br)N |