For research use only. Not for therapeutic Use.
Questin(Cat No.:R066080)is a natural anthraquinone compound found in various plant species, known for its potential medicinal properties, particularly in antimicrobial and anticancer research. This compound has demonstrated promising activity against certain bacterial strains and is being investigated for its role in inhibiting cancer cell growth by affecting cellular signaling pathways. Additionally, Questin’s antioxidant capabilities may contribute to its therapeutic potential, offering protective effects against oxidative stress. Its diverse biological activities make Questin a valuable candidate for further exploration in pharmacology and natural product research.
CAS Number | 3774-64-9 |
Molecular Formula | C16H12O5 |
Purity | ≥95% |
Target | Bacterial |
Storage | -20°C |
IUPAC Name | 1,6-dihydroxy-8-methoxy-3-methylanthracene-9,10-dione |
InChI | InChI=1S/C16H12O5/c1-7-3-9-13(11(18)4-7)16(20)14-10(15(9)19)5-8(17)6-12(14)21-2/h3-6,17-18H,1-2H3 |
InChIKey | UUNPIWCQMVNINR-UHFFFAOYSA-N |
SMILES | CC1=CC(=C2C(=C1)C(=O)C3=CC(=CC(=C3C2=O)OC)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |