For research use only. Not for therapeutic Use.
Pseudocoptisine chloride(Cat No.:I044922)is a quaternary protoberberine alkaloid typically found in plants of the Papaveraceae and Ranunculaceae families. It exhibits a characteristic isoquinoline backbone and is commonly studied in its chloride salt form for enhanced solubility and stability. Pseudocoptisine chloride is noted for its antimicrobial, anti-inflammatory, and potential anticancer properties, acting through mechanisms such as DNA intercalation and enzyme inhibition. It also shows promise in modulating neurotransmitter systems. As a plant-derived bioactive compound, it holds value in pharmacological research focused on infectious diseases, neurological disorders, and cancer therapy.
| CAS Number | 30044-78-1 |
| Synonyms | 5,7,18,20-tetraoxa-13-azoniahexacyclo[11.11.0.02,10.04,8.015,23.017,21]tetracosa-1(24),2,4(8),9,13,15,17(21),22-octaene;chloride |
| Molecular Formula | C19H14ClNO4 |
| Purity | ≥95% |
| IUPAC Name | 5,7,18,20-tetraoxa-13-azoniahexacyclo[11.11.0.02,10.04,8.015,23.017,21]tetracosa-1(24),2,4(8),9,13,15,17(21),22-octaene;chloride |
| InChI | InChI=1S/C19H14NO4.ClH/c1-2-20-8-13-6-18-17(22-9-23-18)5-12(13)3-15(20)14-7-19-16(4-11(1)14)21-10-24-19;/h3-8H,1-2,9-10H2;1H/q+1;/p-1 |
| InChIKey | QBOVLUUBUAZWIN-UHFFFAOYSA-M |
| SMILES | C1C[N+]2=CC3=CC4=C(C=C3C=C2C5=CC6=C(C=C51)OCO6)OCO4.[Cl-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |