PS-341 - CAS 179324-69-7
Bortezomib is a dipeptide boronic acid analogue with antineoplastic activity. Bortezomib reversibly inhibits the 26S proteasome, a large protease complex that degrades ubiquinated proteins. By blocking the targeted proteolysis normally performed by the proteasome, bortezomib disrupts various cell signaling pathways, leading to cell cycle arrest, apoptosis, and inhibition of angiogenesis. Specifically, the agent inhibits nuclear factor (NF)-kappaB, a protein that is constitutively activated in some cancers, thereby interfering with NF-kappaB-mediated cell survival, tumor growth, and angiogenesis. In vivo, bortezomib delays tumor growth and enhances the cytotoxic effects of radiation and chemotherapy.
Catalog Number: A000254
CAS Number: 179324-69-7
PubChem Substance ID:355040070
Molecular Formula: C₁₉H₂₅BN₄O₄
Molecular Weight:384.24
Purity: ≥95%
* For research use only. Not for human or veterinary use.
Synonym
| Synonyms | LDP-341, MLM341 |
|---|
Property
| Molecular Formula: | C₁₉H₂₅BN₄O₄ |
|---|---|
| Molecular Weight | 384.24 |
| Target: | Proteasome |
| Solubility | >19.2mg/mL in DMSO |
| Purity | ≥95% |
| Storage | 3 years -20C powder |
| MDL | MFCD09056737 |
Computed Descriptor
| InChI | InChI=1S/C19H25BN4O4/c1-13(2)10-17(20(27)28)24-18(25)15(11-14-6-4-3-5-7-14)23-19(26)16-12-21-8-9-22-16/h3-9,12-13,15,17,27-28H,10-11H2,1-2H3,(H,23,26)(H,24,25)/t15-,17-/m0/s1 |
|---|---|
| InChIKey | GXJABQQUPOEUTA-RDJZCZTQSA-N |
| SMILES | B(C(CC(C)C)NC(=O)C(CC1=CC=CC=C1)NC(=O)C2=NC=CN=C2)(O)O |