For research use only. Not for therapeutic Use.
PRMT5-IN-4（Cat No.:I044533）is a selective small-molecule inhibitor of protein arginine methyltransferase 5 (PRMT5), an enzyme responsible for symmetric dimethylation of arginine residues on histones and other proteins. PRMT5 plays a key role in gene expression, RNA splicing, and cellular proliferation, and is often overexpressed in various cancers. By inhibiting PRMT5 activity, PRMT5-IN-4 disrupts oncogenic epigenetic regulation and splicing mechanisms, leading to reduced tumor growth and enhanced apoptosis. This compound is widely used in preclinical studies to investigate the therapeutic potential of targeting PRMT5 in hematologic malignancies and solid tumors with PRMT5 or MTAP pathway dependencies.
| CAS Number | 152615-84-4 |
| Synonyms | (2R,3R,4S,5R)-2-(4-aminothieno[3,4-d]pyrimidin-7-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| Molecular Formula | C11H13N3O4S |
| Purity | ≥95% |
| IUPAC Name | (2R,3R,4S,5R)-2-(4-aminothieno[3,4-d]pyrimidin-7-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| InChI | InChI=1S/C11H13N3O4S/c12-11-4-2-19-10(6(4)13-3-14-11)9-8(17)7(16)5(1-15)18-9/h2-3,5,7-9,15-17H,1H2,(H2,12,13,14)/t5-,7-,8-,9-/m1/s1 |
| InChIKey | VTCXCOOTIXNZFE-ZOQUXTDFSA-N |
| SMILES | C1=C2C(=C(S1)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N=CN=C2N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
