For research use only. Not for therapeutic Use.
Pramiracetam（Cat No.:A000412） is a synthetic nootropic compound belonging to the racetam family, known for its cognitive-enhancing properties. Structurally, it is a derivative of piracetam, featuring a dipropan-2-ylaminoethyl side chain that increases its lipophilicity and brain bioavailability. Pramiracetam is believed to enhance memory, learning, and focus by modulating cholinergic activity and possibly influencing high-affinity choline uptake in the brain. It is commonly researched for its potential benefits in neurodegenerative disorders, traumatic brain injury, and cognitive decline. Pramiracetam is valued for its potency and long-lasting effects compared to other racetams.
| CAS Number | 68497-62-1 |
| Synonyms | CI-879 |
| Molecular Formula | C14H27N3O2 |
| Purity | ≥95% |
| Target | Prolyl Endopeptidase (PREP) |
| Storage | 3 years -20C powder |
| IUPAC Name | N-[2-[di(propan-2-yl)amino]ethyl]-2-(2-oxopyrrolidin-1-yl)acetamide |
| InChI | InChI=1S/C14H27N3O2/c1-11(2)17(12(3)4)9-7-15-13(18)10-16-8-5-6-14(16)19/h11-12H,5-10H2,1-4H3,(H,15,18) |
| InChIKey | ZULJGOSFKWFVRX-UHFFFAOYSA-N |
| SMILES | CC(C)N(CCNC(=O)CN1CCCC1=O)C(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
