For research use only. Not for therapeutic Use.
PR-104A（Cat No.:I034983）is a hypoxia-activated prodrug designed for targeted cancer therapy. It is the active metabolite of PR-104 and becomes cytotoxic under low-oxygen conditions commonly found in solid tumors. Once activated, it releases DNA-crosslinking nitrogen mustards that induce cell death, particularly in hypoxic cancer cells. PR-104A can also be activated by the enzyme AKR1C3, broadening its therapeutic potential beyond hypoxic tumors. This dual-activation mechanism allows selective targeting of resistant tumor regions while sparing healthy, oxygenated tissues. PR-104A has shown promise in preclinical and early clinical studies for various cancers.
| CAS Number | 680199-06-8 |
| Synonyms | 2-[N-(2-bromoethyl)-2-(2-hydroxyethylcarbamoyl)-4,6-dinitroanilino]ethyl methanesulfonate |
| Molecular Formula | C14H19BrN4O9S |
| Purity | ≥95% |
| IUPAC Name | 2-[N-(2-bromoethyl)-2-(2-hydroxyethylcarbamoyl)-4,6-dinitroanilino]ethyl methanesulfonate |
| InChI | InChI=1S/C14H19BrN4O9S/c1-29(26,27)28-7-5-17(4-2-15)13-11(14(21)16-3-6-20)8-10(18(22)23)9-12(13)19(24)25/h8-9,20H,2-7H2,1H3,(H,16,21) |
| InChIKey | AZICEEZSDKZDHX-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCCN(CCBr)C1=C(C=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C(=O)NCCO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
