For research use only. Not for therapeutic Use.
Pomalidomide-PEG1-azide(CAT: I016892) is a bifunctional cereblon (CRBN) ligand tailored for the development of PROTACs (proteolysis-targeting chimeras) and other targeted protein degradation tools. It features a pomalidomide moiety, which binds selectively to the E3 ligase CRBN, connected via a short PEG1 spacer to a terminal azide group. The azide handle enables efficient coupling through click chemistry with alkyne-functionalized linkers, ligands, or probes, allowing versatile conjugation strategies. The PEG1 unit enhances solubility and flexibility while reducing steric hindrance. Pomalidomide-PEG1-azide is an essential building block for medicinal chemistry, facilitating the design of CRBN-recruiting degraders and multifunctional bioconjugates.
| CAS Number | 2133360-04-8 |
| Synonyms | 2-(2-azidoethoxy)-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]acetamide |
| Molecular Formula | C17H16N6O6 |
| Purity | ≥95% |
| IUPAC Name | 2-(2-azidoethoxy)-N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]acetamide |
| InChI | InChI=1S/C17H16N6O6/c18-22-19-6-7-29-8-13(25)20-10-3-1-2-9-14(10)17(28)23(16(9)27)11-4-5-12(24)21-15(11)26/h1-3,11H,4-8H2,(H,20,25)(H,21,24,26) |
| InChIKey | SKTGGMFEGRISBY-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)NC(=O)COCCN=[N+]=[N-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
