For research use only. Not for therapeutic Use.
Pleuromutilin(Cat No.:I001024)is a natural antibiotic derived from the mushroom Clitopilus passeckerianus, known for its selective activity against gram-positive bacteria. It works by binding to the bacterial 50S ribosomal subunit, inhibiting protein synthesis and effectively blocking bacterial growth. Pleuromutilin and its derivatives are widely used in veterinary medicine and are being explored for human use, particularly against drug-resistant pathogens like MRSA. In research, it plays a significant role in developing novel antibiotics, offering insights into ribosomal binding mechanisms and providing a promising approach to overcoming antibiotic resistance.
| CAS Number | 125-65-5 |
| Synonyms | 2-hydroxy-acetic acid-(3aS,4R,5S,6S,8R,9R,9aR,10R)-6-ethenyldecahydro-5-hydroxy-4,6,9,10-tetramethyl-1-oxo-3a,9-propano-3aH-cyclopentacycloocten-8-yl ester |
| Molecular Formula | C22H34O5 |
| Purity | ≥95% |
| Target | Bacterial |
| Solubility | 10 mM in DMSO |
| Storage | Store at 4°C |
| IUPAC Name | [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-hydroxyacetate |
| InChI | InChI=1S/C22H34O5/c1-6-20(4)11-16(27-17(25)12-23)21(5)13(2)7-9-22(14(3)19(20)26)10-8-15(24)18(21)22/h6,13-14,16,18-19,23,26H,1,7-12H2,2-5H3/t13-,14+,16-,18+,19+,20-,21+,22+/m1/s1 |
| InChIKey | ZRZNJUXESFHSIO-BKUNHTPHSA-N |
| SMILES | C[C@@H]1CC[C@@]23CCC(=O)[C@H]2[C@@]1([C@@H](C[C@@]([C@H]([C@@H]3C)O)(C)C=C)OC(=O)CO)C |
| Reference | <p style=/line-height:25px/> </p> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |