For research use only. Not for therapeutic Use.
Pirarubicin(Cat No.:A000632)is an anthracycline anticancer agent used in the treatment of various solid tumors, including breast cancer and bladder cancer. It works by intercalating into DNA, thereby inhibiting topoisomerase II, which prevents DNA replication and transcription, ultimately leading to cell death. Pirarubicin is a derivative of doxorubicin, but with reduced cardiotoxicity, making it a safer option in chemotherapy regimens. Its efficacy in inhibiting tumor growth, along with its relatively lower risk of heart-related side effects, makes it valuable in oncology for both research and clinical applications.
| CAS Number | 72496-41-4 |
| Synonyms | 72496-41-4; MFCD00869742; Theprubicin; THP-doxorubicin; C32H37NO12 |
| Molecular Formula | C32H37NO12 |
| Purity | ≥95% |
| Target | Autophagy |
| Solubility | >7.65mg/mL in DMSO |
| Storage | -20°C |
| IUPAC Name | (7S,9S)-7-[(2R,4S,5S,6S)-4-amino-6-methyl-5-[(2R)-oxan-2-yl]oxyoxan-2-yl]oxy-6,9,11-trihydroxy-9-(2-hydroxyacetyl)-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
| InChI | InChI=1S/C32H37NO12/c1-14-31(45-21-8-3-4-9-42-21)17(33)10-22(43-14)44-19-12-32(40,20(35)13-34)11-16-24(19)30(39)26-25(28(16)37)27(36)15-6-5-7-18(41-2)23(15)29(26)38/h5-7,14,17,19,21-22,31,34,37,39-40H,3-4,8-13,33H2,1-2H3/t14-,17-,19-,21+,22-,31+,32-/m0/s1 |
| InChIKey | KMSKQZKKOZQFFG-YXRRJAAWSA-N |
| SMILES | C[C@H]1[C@H]([C@H](C[C@@H](O1)O[C@H]2C[C@@](CC3=C2C(=C4C(=C3O)C(=O)C5=C(C4=O)C(=CC=C5)OC)O)(C(=O)CO)O)N)O[C@@H]6CCCCO6 |
| Reference | 1: Miyamoto K, Ito A, Wakabayashi M, Eba J, Arai Y, Nishiyama H, Sugimoto M, 2: Islam W, Fang J, Etrych T, Chytil P, Ulbrich K, Sakoguchi A, Kusakabe K, Maeda 3: Wang YD, Zhang Y, Sun B, Leng XW, Li YJ, Ren LQ. Cardioprotective effects of 4: Mizutani H, Hotta S, Nishimoto A, Ikemura K, Miyazawa D, Ikeda Y, Maeda T, 5: Jiang B, Dong Y, He H, Han C. Application of pirarubicin photosensitizer 6: Fang Z, Wang Y, Li H, Yu S, Liu Z, Fan Z, Chen X, Wu Y, Pan X, Li X, Wang C. <br> 8: Wang Y, Zhang Y, Sun B, Tong Q, Ren L. Rutin Protects against 9: Deng C, Jia M, Wei G, Tan T, Fu Y, Gao H, Sun X, Zhang Q, Gong T, Zhang Z. <br> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |