For research use only. Not for therapeutic Use.
Phytolaccagenin(Cat No.:M122604)is a triterpenoid saponin and the active ingredient found in the plant tongue root (Phytolacca spp.). It possesses various beneficial properties, including antifungal and anti-inflammatory activities. Phytolaccagenin has been studied for its potential use in treating fungal infections and inflammatory conditions. It exhibits low toxicity, making it a promising natural compound for therapeutic applications. The compound’s presence in tongue root highlights its potential as a valuable source of bioactive compounds with diverse pharmacological activities and further exploration in drug development and natural medicine.
| CAS Number | 1802-12-6 |
| Molecular Formula | C31H48O7 |
| Purity | ≥95% |
| Target | Bacterial |
| Storage | Store at -20°C |
| IUPAC Name | (2S,4aR,6aR,6aS,6bR,8aR,9R,10R,11S,12aR,14bS)-10,11-dihydroxy-9-(hydroxymethyl)-2-methoxycarbonyl-2,6a,6b,9,12a-pentamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
| InChI | InChI=1S/C31H48O7/c1-26(25(37)38-6)11-13-31(24(35)36)14-12-29(4)18(19(31)15-26)7-8-22-27(2)16-20(33)23(34)28(3,17-32)21(27)9-10-30(22,29)5/h7,19-23,32-34H,8-17H2,1-6H3,(H,35,36)/t19-,20-,21+,22+,23-,26-,27-,28-,29+,30+,31-/m0/s1 |
| InChIKey | CYJWWQALTIKOAG-FLORRLIPSA-N |
| SMILES | CC1(CCC2(CCC3(C(=CCC4C3(CCC5C4(CC(C(C5(C)CO)O)O)C)C)C2C1)C)C(=O)O)C(=O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |