Phenibut (Hydrochloride)(CAT: R067676) is a nootropic compound widely recognized for its anxiolytic and neuroprotective properties. Structurally similar to the neurotransmitter GABA, Phenibut crosses the blood-brain barrier and exerts its effects by binding to GABA-B receptors, leading to reduced anxiety, enhanced cognitive function, and improved sleep quality. This hydrochloride salt form ensures better stability and solubility, making it ideal for research applications. Phenibut (Hydrochloride) is valuable for studying the modulation of GABAergic neurotransmission, neuroprotection, and the potential therapeutic uses of nootropics in treating anxiety and cognitive disorders. Researchers focused on neuroscience and psychopharmacology will find this compound crucial for advancing their studies in mental health and cognitive enhancement.
Catalog Number | R067676 |
CAS Number | 3060-41-1 |
Synonyms | γ-Amino-β-phenylbutyric Acid;β-phenyl-γ-Aminobutyric Acid;β-phenyl-GABA |
Molecular Formula | C10H14ClNO2 |
Purity | 95% |
Storage | -20°C |
IUPAC Name | 4-amino-3-phenylbutanoic acid;hydrochloride |
InChI | InChI=1S/C10H13NO2.ClH/c11-7-9(6-10(12)13)8-4-2-1-3-5-8;/h1-5,9H,6-7,11H2,(H,12,13);1H |
InChIKey | XSYRYMGYPBGOPS-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)[C@H](CC(=O)O)CN.[Cl] |