For research use only. Not for therapeutic Use.
Peroxidase(CAT: I017139) is an essential oxidative enzyme that catalyzes the reduction of hydrogen peroxide (H₂O₂) and organic peroxides into water and corresponding alcohols, using various electron donors. This enzymatic activity plays a crucial role in biochemical and clinical research, particularly in oxidative stress studies, biosensing, and immunoassays. Horseradish peroxidase (HRP), a commonly used form, is widely employed in diagnostic assays such as ELISA and Western blotting due to its ability to amplify signal detection. Additionally, peroxidases are pivotal in studying cellular defense mechanisms against oxidative damage and in developing antioxidant therapies.
| CAS Number | 9003-99-0 |
| Molecular Formula | C23H20N6O |
| Purity | ≥95% |
| Target | NF-κB |
| IUPAC Name | N-(2-aminophenyl)-4-[[(4-pyridin-3-ylpyrimidin-2-yl)amino]methyl]benzamide |
| InChI | InChI=1S/C23H20N6O/c24-19-5-1-2-6-21(19)28-22(30)17-9-7-16(8-10-17)14-27-23-26-13-11-20(29-23)18-4-3-12-25-15-18/h1-13,15H,14,24H2,(H,28,30)(H,26,27,29) |
| InChIKey | HRNLUBSXIHFDHP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)NC(=O)C2=CC=C(C=C2)CNC3=NC=CC(=N3)C4=CN=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |