For research use only. Not for therapeutic Use.
| CAS Number | 110956-75-7 |
| Molecular Formula | C17H17ClFNO4 |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | 3-(4-chloro-5-cyclopentyloxy-2-fluorophenyl)-5-propan-2-ylidene-1,3-oxazolidine-2,4-dione |
| InChI | InChI=1S/C17H17ClFNO4/c1-9(2)15-16(21)20(17(22)24-15)13-8-14(11(18)7-12(13)19)23-10-5-3-4-6-10/h7-8,10H,3-6H2,1-2H3 |
| InChIKey | JZPKLLLUDLHCEL-UHFFFAOYSA-N |
| SMILES | CC(=C1C(=O)N(C(=O)O1)C2=CC(=C(C=C2F)Cl)OC3CCCC3)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |