For research use only. Not for therapeutic Use.
PD 174265（Cat No.:I008620）is a potent, selective inhibitor of the protein kinase C (PKC) family, specifically targeting PKC epsilon (ε) and PKC delta (δ) isoforms. It is used in research to explore PKC’s role in various cellular processes, including cell proliferation, apoptosis, and inflammation. PD 174265 is valuable in studying cancer, cardiovascular diseases, and neurodegenerative disorders, where PKC isoforms are implicated in disease progression. Its selective inhibition allows for precise investigation of PKC-mediated signaling pathways and potential therapeutic applications.
| CAS Number | 216163-53-0 |
| Synonyms | N-[4-(3-bromoanilino)quinazolin-6-yl]propanamide |
| Molecular Formula | C17H15BrN4O |
| Purity | ≥95% |
| IUPAC Name | N-[4-(3-bromoanilino)quinazolin-6-yl]propanamide |
| InChI | InChI=1S/C17H15BrN4O/c1-2-16(23)21-13-6-7-15-14(9-13)17(20-10-19-15)22-12-5-3-4-11(18)8-12/h3-10H,2H2,1H3,(H,21,23)(H,19,20,22) |
| InChIKey | WUPUZEMRHDROEO-UHFFFAOYSA-N |
| SMILES | CCC(=O)NC1=CC2=C(C=C1)N=CN=C2NC3=CC(=CC=C3)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
