Papain（Cat No.:R070841）, is a proteolytic enzyme derived from the papaya fruit (Carica papaya). It is widely utilized in various industries, including food, pharmaceuticals, and cosmetics. Papain is renowned for its protein-digesting properties and is often used as a meat tenderizer and in the production of cheese, beer, and certain food products. In the pharmaceutical field, it is employed in wound care and as a digestive aid in enzyme supplements. Papain is also found in some skincare products due to its exfoliating properties. Its versatility and ability to break down proteins make it a valuable enzyme with diverse applications.
| Catalog Number | R070841 |
| CAS Number | 9001-73-4 |
| Molecular Formula | C9H14N4O3 |
| Purity | ≥95% |
| Storage | 2-8°C |
| IUPAC Name | 2-(3-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanoic acid |
| InChI | InChI=1S/C9H14N4O3/c10-2-1-8(14)13-7(9(15)16)3-6-4-11-5-12-6/h4-5,7H,1-3,10H2,(H,11,12)(H,13,14)(H,15,16) |
| InChIKey | CQOVPNPJLQNMDC-UHFFFAOYSA-N |
| SMILES | C1=C(NC=N1)CC(C(=O)O)NC(=O)CCN |
