Polyoxyethylene (5) sorbitan monooleate(Cat No.:R071339), is a nonionic surfactant and emulsifying agent commonly known as Tween 80. It is synthesized by ethoxylation of sorbitan monooleate and is used in various industries, including pharmaceuticals, food, and cosmetics. Tween 80 is a versatile emulsifier, stabilizing oil-in-water emulsions, and enhancing solubility of poorly water-soluble substances. In pharmaceuticals, it aids in drug delivery, while in the food industry, it improves texture and flavor in products like ice cream. Additionally, it finds application in cosmetics for its ability to create stable formulations and enhance the dispersion of ingredients in skincare and haircare products.
Catalog Number | R071339 |
CAS Number | 9005-65-6 |
Synonyms | Tween 81 |
Molecular Formula | C32H60O10 |
Purity | 95% |
Storage | -20°C |
IUPAC Name | 2-[2-[3,4-bis(2-hydroxyethoxy)oxolan-2-yl]-2-(2-hydroxyethoxy)ethoxy]ethyl octadec-9-enoate |
InChI | InChI=1S/C32H60O10/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-30(36)40-25-24-37-26-28(38-21-18-33)32-31(41-23-20-35)29(27-42-32)39-22-19-34/h9-10,28-29,31-35H,2-8,11-27H2,1H3 |
InChIKey | HDTIFOGXOGLRCB-UHFFFAOYSA-N |
SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCCOCC(C1C(C(CO1)OCCO)OCCO)OCCO |