For research use only. Not for therapeutic Use.
PAC1R Antagonist 1（Cat No.:I043661）is a selective inhibitor of the PAC1 receptor, which is a G protein-coupled receptor (GPCR) involved in regulating various physiological processes, including neuroprotection and cognitive function. By blocking the PAC1 receptor, this compound is used in research to investigate the role of PAC1 in neurological disorders and related pathologies. It holds potential for therapeutic applications in treating conditions such as depression, anxiety, and other central nervous system disorders. PAC1R Antagonist 1 serves as a valuable tool in the development of novel neuroactive therapies.
| CAS Number | 2305204-24-2 |
| Synonyms | 1-(7-chloro-1H-indazol-3-yl)-N-[2-(1H-imidazol-5-yl)ethyl]-5-oxopyrrolidine-3-carboxamide |
| Molecular Formula | C17H17ClN6O2 |
| Purity | ≥95% |
| IUPAC Name | 1-(7-chloro-1H-indazol-3-yl)-N-[2-(1H-imidazol-5-yl)ethyl]-5-oxopyrrolidine-3-carboxamide |
| InChI | InChI=1S/C17H17ClN6O2/c18-13-3-1-2-12-15(13)22-23-16(12)24-8-10(6-14(24)25)17(26)20-5-4-11-7-19-9-21-11/h1-3,7,9-10H,4-6,8H2,(H,19,21)(H,20,26)(H,22,23) |
| InChIKey | MCXQHNLGSHUYBL-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)C2=NNC3=C2C=CC=C3Cl)C(=O)NCCC4=CN=CN4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
