For research use only. Not for therapeutic Use.
p-Anisidine (CAT: R019317) is a chemical compound with significance in the fields of organic chemistry and material science. It is commonly used as a building block in the synthesis of various organic compounds, including dyes, pharmaceuticals, and antioxidants. Its aromatic structure and reactivity make it valuable for the creation of diverse chemical products. Additionally, p-Anisidine is employed as a precursor in the production of azo dyes, which find applications in textiles and other industries.
CAS Number | 104-94-9 |
Synonyms | 1,4-Anisidine; 4-Methoxybenzenamine; 1-Amino-4-methoxybenzene; 4-Aminoanisole; 4-Aminomethoxybenzene; 4-Methoxy-1-aminobenzene; 4-Methoxyaniline; 4-Methoxybenzenamine; 4-Methoxylaniline; 4-Methoxyphenylamine; Anisidine; Methyl 4-aminophenyl ether; NS |
Molecular Formula | C7H9NO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-methoxyaniline |
InChI | InChI=1S/C7H9NO/c1-9-7-4-2-6(8)3-5-7/h2-5H,8H2,1H3 |
InChIKey | BHAAPTBBJKJZER-UHFFFAOYSA-N |
SMILES | COC1=CC=C(C=C1)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |