(3E)-4,8-dimethylnona-1,3,7-triene(CAT: M000282), is a naturally occurring terpene that is found in many essential oils, such as lemongrass, lemon myrtle, and lemon verbena. Citral has a lemon-like scent and is widely used as a flavor and fragrance ingredient in the food, cosmetic, and fragrance industries. Citral has also been investigated for its potential medicinal properties, such as its antimicrobial, antioxidant, and anti-inflammatory activities. It has been shown to have a variety of biological effects, such as reducing blood pressure, improving digestion, and enhancing the immune system. It has also been studied for its potential use in the treatment of cancer, Alzheimer’s disease, and other medical conditions.
Catalog Number | M000282 |
CAS Number | 19945-61-0 |
Molecular Formula | C11H18 |
Purity | 95% |
Storage | -20°C |
IUPAC Name | (3E)-4,8-dimethylnona-1,3,7-triene |
InChI | InChI=1S/C11H18/c1-5-7-11(4)9-6-8-10(2)3/h5,7-8H,1,6,9H2,2-4H3/b11-7+ |
InChIKey | LUKZREJJLWEWQM-YRNVUSSQSA-N |
SMILES | CC(=CCCC(=CC=C)C)C |