Oxybenzone(CAT: A000027) is an organic compound commonly used as an active ingredient in sunscreens and other personal care products to protect the skin from ultraviolet (UV) radiation. It primarily absorbs UVB and some UVA rays, preventing them from penetrating the skin and causing damage such as sunburn and long-term effects like photoaging and skin cancer. Oxybenzone is also utilized in various cosmetics and products for its UV-filtering properties. However, concerns have been raised regarding its potential environmental impact, particularly its contribution to coral reef bleaching, leading to restrictions on its use in some areas. Additionally, its safety profile has been debated due to its potential for skin absorption and hormonal disruption.
Catalog Number | A000027 |
CAS Number | 131-57-7 |
Synonyms | Oxybenzone, Eusolex 4360, Escalol 567, KAHSCREEN BZ-3, Benzophenone 3 |
Molecular Formula | C14H12O3 |
Purity | ≥95% |
Storage | Store at -20°C |
InChI | 1S/C14H12O3/c1-17-11-7-8-12(13(15)9-11)14(16)10-5-3-2-4-6-10/h2-9,15H,1H3 |
InChIKey | DXGLGDHPHMLXJC-UHFFFAOYSA-N |
SMILES | O=C(C1=CC=C(OC)C=C1O)C2=CC=CC=C2 |