For research use only. Not for therapeutic Use.
Oxibendazole(Cat No.:A000352)is a broad-spectrum benzimidazole anthelmintic commonly used to treat parasitic infections in animals, including horses, cattle, and dogs. It works by inhibiting tubulin polymerization, which disrupts the formation of microtubules in parasite cells, leading to impaired cellular functions and eventual death of the parasite. Effective against a range of intestinal worms, such as roundworms, strongyles, and pinworms, oxibendazole is valued for its efficacy and safety in veterinary medicine. Its ability to target parasite microtubules makes it a crucial component in parasite control programs for livestock and pets.
| CAS Number | 20559-55-1 |
| Synonyms | 20559-55-1; Oxibendazolo; Oxibendazolum; Loditac; Filaribits Plus |
| Molecular Formula | C12H15N3O3 |
| Purity | ≥95% |
| Target | Apoptosis |
| Storage | -20°C |
| IUPAC Name | methyl N-(6-propoxy-1H-benzimidazol-2-yl)carbamate |
| InChI | InChI=1S/C12H15N3O3/c1-3-6-18-8-4-5-9-10(7-8)14-11(13-9)15-12(16)17-2/h4-5,7H,3,6H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | RAOCRURYZCVHMG-UHFFFAOYSA-N |
| SMILES | CCCOC1=CC2=C(C=C1)N=C(N2)NC(=O)OC |
| Reference | 1: Lyons ET, Tolliver SC, Kuzmina TA, Collins SS. Further evaluation in field 2: Traversa D, Iorio R, Otranto D, Giangaspero A, Milillo P, Klei TR. <br> 4: Magambo JK. Ultrastructural changes in Ascaris suum after oxibendazole 5: Gokbulut C, Nolan AM, McKellar QA. Plasma disposition, faecal excretion and in 6: Overgaauw PA, Boersema JH. Anthelmintic efficacy of oxibendazole against some <br> 8: Rolfe PF, Dawson KL. The efficacy of a combination anthelmintic against 9: Lyons ET, Drudge JH, Tolliver SC, Swerczek TW, Stamper S, Granstrom DE. 10: Tolliver SC, Lyons ET, Drudge JH, Stamper S, Granstrom DE. Critical tests of |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |