For research use only. Not for therapeutic Use.
Oxaprozin-d4(Cat No.:S000408) is a deuterated form of oxaprozin, where four hydrogen atoms are replaced with deuterium. This modification enhances the drug’s metabolic stability, making it particularly useful for detailed pharmacokinetic studies. Oxaprozin is a nonsteroidal anti-inflammatory drug (NSAID) used to treat arthritis symptoms such as inflammation, swelling, and pain. It works by inhibiting cyclooxygenase enzymes and reducing the production of prostaglandins involved in pain and inflammation. The deuterated version, Oxaprozin-d4, allows researchers to explore the drug’s absorption, distribution, metabolism, and excretion more accurately, improving understanding of its therapeutic profile.
Molecular Formula | C18H11D4NO3 |
Purity | ≥95% |
Target | COX |
IUPAC Name | 2,2,3,3-tetradeuterio-3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoic acid |
InChI | InChI=1S/C18H15NO3/c20-16(21)12-11-15-19-17(13-7-3-1-4-8-13)18(22-15)14-9-5-2-6-10-14/h1-10H,11-12H2,(H,20,21)/i11D2,12D2 |
InChIKey | OFPXSFXSNFPTHF-AREBVXNXSA-N |
SMILES | C1=CC=C(C=C1)C2=C(OC(=N2)CCC(=O)O)C3=CC=CC=C3 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |