Obtusifoliol(CAT: M087311) is a naturally occurring triterpenoid compound found in various plant species. Its mode of action involves being a bioactive compound with potential biological activities. Pharmacologically, obtusifoliol has been studied for its various effects, including anti-inflammatory, antioxidant, and antifungal properties. It has shown promise in preclinical studies, demonstrating its potential as a natural anti-inflammatory agent to inhibit inflammatory mediators, scavenge free radicals, and exhibit antifungal activity against certain fungi.
Catalog Number | M087311 |
CAS Number | 16910-32-0 |
Molecular Formula | C30H50O |
Purity | 95% |
Storage | Store at -20C |
IUPAC Name | (3S,4S,5S,10S,13R,14R,17R)-4,10,13,14-tetramethyl-17-[(2R)-6-methyl-5-methylideneheptan-2-yl]-1,2,3,4,5,6,7,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
InChI | InChI=1S/C30H50O/c1-19(2)20(3)9-10-21(4)23-13-17-30(8)26-12-11-24-22(5)27(31)15-16-28(24,6)25(26)14-18-29(23,30)7/h19,21-24,27,31H,3,9-18H2,1-2,4-8H3/t21-,22+,23-,24+,27+,28+,29-,30+/m1/s1 |
InChIKey | MMNYKQIDRZNIKT-VSADUBDNSA-N |
SMILES | CC1C2CCC3=C(C2(CCC1O)C)CCC4(C3(CCC4C(C)CCC(=C)C(C)C)C)C |