For research use only. Not for therapeutic Use.
O4I4 (CAT: I040886) is an OCT4-inducing compound that promotes the expression of the pluripotency transcription factor OCT4, which plays a crucial role in stem cell self-renewal and differentiation. Known for its metabolic stability, O4I4 has shown the ability to extend lifespan in model organisms such as Caenorhabditis elegans and Drosophila. By enhancing OCT4 expression, O4I4 holds potential for regenerative medicine, supporting tissue repair and rejuvenation processes. It can be used in research focused on stem cell biology, aging, and regenerative therapies, making it particularly relevant for regenerative medicine and rejuvenation research.
| CAS Number | 412008-21-0 |
| Synonyms | 4-tert-butyl-N-(2,3-dimethylphenyl)-1,3-thiazol-2-amine |
| Molecular Formula | C15H20N2S |
| Purity | ≥95% |
| IUPAC Name | 4-tert-butyl-N-(2,3-dimethylphenyl)-1,3-thiazol-2-amine |
| InChI | InChI=1S/C15H20N2S/c1-10-7-6-8-12(11(10)2)16-14-17-13(9-18-14)15(3,4)5/h6-9H,1-5H3,(H,16,17) |
| InChIKey | DNOVKAUCGLWSEE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)NC2=NC(=CS2)C(C)(C)C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |