Zymosterol(CAT: R040070) is a sterol compound found in various biological sources, including plants and microorganisms. It serves as an intermediate in the biosynthesis of cholesterol and other sterols in organisms. Zymosterol plays a crucial role in the sterol biosynthesis pathway, contributing to the production of membrane components and steroid hormones. Its presence and function are essential for maintaining the structural integrity and fluidity of cell membranes.
Catalog Number | R040070 |
CAS Number | 128-33-6 |
Synonyms | (3β,5α)-Cholesta-8,24-dien-3-ol; 5α-Cholesta-8,24-dien-3β-ol; |
Molecular Formula | C27H44O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (3S,5S,10S,13R,14R,17R)-10,13-dimethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,4,5,6,7,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
InChI | InChI=1S/C27H44O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h7,19-21,23-24,28H,6,8-17H2,1-5H3/t19-,20+,21+,23-,24+,26+,27-/m1/s1 |
InChIKey | CGSJXLIKVBJVRY-XTGBIJOFSA-N |
SMILES | CC(CCC=C(C)C)C1CCC2C1(CCC3=C2CCC4C3(CCC(C4)O)C)C |