Zymosterol - CAS 128-33-6

Zymosterol(CAT: R040070) is a sterol compound found in various biological sources, including plants and microorganisms. It serves as an intermediate in the biosynthesis of cholesterol and other sterols in organisms. Zymosterol plays a crucial role in the sterol biosynthesis pathway, contributing to the production of membrane components and steroid hormones. Its presence and function are essential for maintaining the structural integrity and fluidity of cell membranes.

Catalog Number: R040070

CAS Number: 128-33-6

PubChem Substance ID:355434401

Molecular Formula: C27H44O

Molecular Weight:384.648

Purity: ≥95%

* For research use only. Not for human or veterinary use.

Synonym

Synonyms(3β,5α)-Cholesta-8,24-dien-3-ol; 5α-Cholesta-8,24-dien-3β-ol;

Property

Molecular Formula: C27H44O
Molecular Weight384.648
Purity≥95%
Storage-20°C

Computed Descriptor

IUPAC Name(3S,5S,10S,13R,14R,17R)-10,13-dimethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,4,5,6,7,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol
InChIInChI=1S/C27H44O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h7,19-21,23-24,28H,6,8-17H2,1-5H3/t19-,20+,21+,23-,24+,26+,27-/m1/s1
InChIKeyCGSJXLIKVBJVRY-XTGBIJOFSA-N
SMILESCC(CCC=C(C)C)C1CCC2C1(CCC3=C2CCC4C3(CCC(C4)O)C)C