NSC228155(CAT: I011590)is a small molecule inhibitor of the enzyme 3-hydroxy-3-methylglutaryl coenzyme A (HMG-CoA) reductase, which is involved in cholesterol biosynthesis. By inhibiting HMG-CoA reductase, NSC228155 reduces the production of cholesterol in the liver, leading to decreased levels of low-density lipoprotein (LDL) or “bad” cholesterol in the bloodstream. This property has led to its use in research and the development of pharmaceuticals for the treatment of hypercholesterolemia and other cardiovascular diseases. NSC228155 has also been investigated for its potential anticancer effects, as it may inhibit the growth and proliferation of cancer cells.
| Catalog Number | I011590 |
| CAS Number | 113104-25-9 |
| Synonyms | 2-((7-nitrobenzo[c][1,2,5]oxadiazol-4-yl)thio)pyridine 1-oxide |
| Molecular Formula | C11H6N4O4S |
| Purity | 95% |
| Target | EGFR |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | 7-nitro-4-(1-oxidopyridin-1-ium-2-yl)sulfanyl-2,1,3-benzoxadiazole |
| InChI | InChI=1S/C11H6N4O4S/c16-14-6-2-1-3-9(14)20-8-5-4-7(15(17)18)10-11(8)13-19-12-10/h1-6H |
| InChIKey | ICCFXXDUYSPKOL-UHFFFAOYSA-N |
| SMILES | C1=CC=[N+](C(=C1)SC2=CC=C(C3=NON=C23)[N+](=O)[O-])[O-] |
