For research use only. Not for therapeutic Use.
NS-1619 (Cat No.:I001932) is a compound that selectively activates large conductance Ca2+ -activated K+ (BK) channels. BK channels are found in various tissues and play important roles in regulating smooth muscle tone, neuronal excitability, and neurotransmitter release. NS-1619 binds to a specific site on the BK channel, leading to channel opening and subsequent hyperpolarization of the cell membrane.
CAS Number | 153587-01-0 |
Synonyms | 1-(2-hydroxy-5-(trifluoromethyl)phenyl)-5-(trifluoromethyl)-1H-benzo[d]imidazol-2(3H)-one |
Molecular Formula | C15H8F6N2O2 |
Purity | ≥95% |
Target | Apoptosis |
Solubility | DMSO: ≥ 31 mg/mL |
Storage | 2-8°C |
IUPAC Name | 3-[2-hydroxy-5-(trifluoromethyl)phenyl]-6-(trifluoromethyl)-1H-benzimidazol-2-one |
InChI | InChI=1S/C15H8F6N2O2/c16-14(17,18)7-1-3-10-9(5-7)22-13(25)23(10)11-6-8(15(19,20)21)2-4-12(11)24/h1-6,24H,(H,22,25) |
InChIKey | YLFMCMWKHSDUCT-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=C1C(F)(F)F)NC(=O)N2C3=C(C=CC(=C3)C(F)(F)F)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |